C28H29F6N5O2 — CID 20773395
N-[4-[1,1,1,3,3,3-hexafluoro-2-(2-piperidin-1-ylethoxy)propan-2-yl]phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide (PubChem CID 20773395) has the molecular formula C28H29F6N5O2 and a molecular weight of 581.56 g/mol. Its IUPAC name is N-[4-[1,1,1,3,3,3-hexafluoro-2-(2-piperidin-1-ylethoxy)propan-2-yl]phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide.
| Compound Name | N-[4-[1,1,1,3,3,3-hexafluoro-2-(2-piperidin-1-ylethoxy)propan-2-yl]phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 20773395 |
| Molecular Formula | C28H29F6N5O2 |
| Molecular Weight | 581.56 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | N-[4-[1,1,1,3,3,3-hexafluoro-2-(2-piperidin-1-ylethoxy)propan-2-yl]phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C(OCCN2CCCCC2)(C(F)(F)F)C(F)(F)F)cc1)c1cccnc1NCc1ccncc1 |
| InChI | InChI=1S/C28H29F6N5O2/c29-27(30,31)26(28(32,33)34,41-18-17-39-15-2-1-3-16-39)21-6-8-22(9-7-21)38-25(40)23-5-4-12-36-24(23)37-19-20-10-13-35-14-11-20/h4-14H,1-3,15-19H2,(H,36,37)(H,38,40) |
| InChIKey | BKZRZDZTQLUCEE-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |