About [1-(3,3-dimethylbutylcarbamoyl)cyclopropyl]azanide
[1-(3,3-dimethylbutylcarbamoyl)cyclopropyl]azanide (PubChem CID 20773509) has the molecular formula C10H19N2O-
and a molecular weight of 183.27 g/mol. Its IUPAC name is [1-(3,3-dimethylbutylcarbamoyl)cyclopropyl]azanide.
Molecular Properties
| Compound Name | [1-(3,3-dimethylbutylcarbamoyl)cyclopropyl]azanide |
| PubChem CID | 20773509 |
| Molecular Formula | C10H19N2O- |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.15 |
| IUPAC Name | [1-(3,3-dimethylbutylcarbamoyl)cyclopropyl]azanide |
| SMILES | CC(C)(C)CCNC(=O)C1([NH-])CC1 |
| InChI | InChI=1S/C10H19N2O/c1-9(2,3)6-7-12-8(13)10(11)4-5-10/h11H,4-7H2,1-3H3,(H,12,13)/q-1 |
| InChIKey | BUNSVGCBNSACJW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [1-(3,3-dimethylbutylcarbamoyl)cyclopropyl]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,3-dimethylbutylcarbamoyl)cyclopropyl]azanide?
The IUPAC name of [1-(3,3-dimethylbutylcarbamoyl)cyclopropyl]azanide (CID 20773509) is [1-(3,3-dimethylbutylcarbamoyl)cyclopropyl]azanide.
What is the SMILES notation for [1-(3,3-dimethylbutylcarbamoyl)cyclopropyl]azanide?
The canonical SMILES for [1-(3,3-dimethylbutylcarbamoyl)cyclopropyl]azanide is CC(C)(C)CCNC(=O)C1([NH-])CC1.
What is the InChIKey of [1-(3,3-dimethylbutylcarbamoyl)cyclopropyl]azanide?
The InChIKey is BUNSVGCBNSACJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N2O/c1-9(2,3)6-7-12-8(13)10(11)4-5-10/h11H,4-7H2,1-3H3,(H,12,13)/q-1.
What are the key properties of [1-(3,3-dimethylbutylcarbamoyl)cyclopropyl]azanide?
[1-(3,3-dimethylbutylcarbamoyl)cyclopropyl]azanide has a molecular weight of 183.27 g/mol, XLogP of 2.12, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,3-dimethylbutylcarbamoyl)cyclopropyl]azanide is sourced from PubChem (CID 20773509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).