About 5-tert-butyl-3-(2,2-dimethylpropyl)-1,2,4-oxadiazole
5-tert-butyl-3-(2,2-dimethylpropyl)-1,2,4-oxadiazole (PubChem CID 20774334) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is 5-tert-butyl-3-(2,2-dimethylpropyl)-1,2,4-oxadiazole.
Analyze 5-tert-butyl-3-(2,2-dimethylpropyl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-3-(2,2-dimethylpropyl)-1,2,4-oxadiazole?
The IUPAC name of 5-tert-butyl-3-(2,2-dimethylpropyl)-1,2,4-oxadiazole (CID 20774334) is 5-tert-butyl-3-(2,2-dimethylpropyl)-1,2,4-oxadiazole.
What is the SMILES notation for 5-tert-butyl-3-(2,2-dimethylpropyl)-1,2,4-oxadiazole?
The canonical SMILES for 5-tert-butyl-3-(2,2-dimethylpropyl)-1,2,4-oxadiazole is CC(C)(C)Cc1noc(C(C)(C)C)n1.
What is the InChIKey of 5-tert-butyl-3-(2,2-dimethylpropyl)-1,2,4-oxadiazole?
The InChIKey is UGCCRRSNQMDJPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O/c1-10(2,3)7-8-12-9(14-13-8)11(4,5)6/h7H2,1-6H3.
What are the key properties of 5-tert-butyl-3-(2,2-dimethylpropyl)-1,2,4-oxadiazole?
5-tert-butyl-3-(2,2-dimethylpropyl)-1,2,4-oxadiazole has a molecular weight of 196.29 g/mol, XLogP of 2.96, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-3-(2,2-dimethylpropyl)-1,2,4-oxadiazole is sourced from PubChem (CID 20774334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).