C20H20N2O3 — CID 20774642
ethyl 3-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate (PubChem CID 20774642) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is ethyl 3-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate.
| Compound Name | ethyl 3-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 20774642 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | ethyl 3-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(/C=C2\C(=O)Nc3ccccc32)c2c1CCCC2 |
| InChI | InChI=1S/C20H20N2O3/c1-2-25-20(24)18-14-9-4-3-7-12(14)17(21-18)11-15-13-8-5-6-10-16(13)22-19(15)23/h5-6,8,10-11,21H,2-4,7,9H2,1H3,(H,22,23)/b15-11- |
| InChIKey | YTLKYUPUKNSMKI-PTNGSMBKSA-N |
| XLogP | 3.56 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|