About ethyl 5-ethyl-1,3-thiazole-2-carboxylate
ethyl 5-ethyl-1,3-thiazole-2-carboxylate (PubChem CID 20775037) has the molecular formula C8H11NO2S
and a molecular weight of 185.25 g/mol. Its IUPAC name is ethyl 5-ethyl-1,3-thiazole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-ethyl-1,3-thiazole-2-carboxylate |
| PubChem CID | 20775037 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | ethyl 5-ethyl-1,3-thiazole-2-carboxylate |
| SMILES | CCOC(=O)c1ncc(CC)s1 |
| InChI | InChI=1S/C8H11NO2S/c1-3-6-5-9-7(12-6)8(10)11-4-2/h5H,3-4H2,1-2H3 |
| InChIKey | YEXMICFPALTRHK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5-ethyl-1,3-thiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-ethyl-1,3-thiazole-2-carboxylate?
The IUPAC name of ethyl 5-ethyl-1,3-thiazole-2-carboxylate (CID 20775037) is ethyl 5-ethyl-1,3-thiazole-2-carboxylate.
What is the SMILES notation for ethyl 5-ethyl-1,3-thiazole-2-carboxylate?
The canonical SMILES for ethyl 5-ethyl-1,3-thiazole-2-carboxylate is CCOC(=O)c1ncc(CC)s1.
What is the InChIKey of ethyl 5-ethyl-1,3-thiazole-2-carboxylate?
The InChIKey is YEXMICFPALTRHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S/c1-3-6-5-9-7(12-6)8(10)11-4-2/h5H,3-4H2,1-2H3.
What are the key properties of ethyl 5-ethyl-1,3-thiazole-2-carboxylate?
ethyl 5-ethyl-1,3-thiazole-2-carboxylate has a molecular weight of 185.25 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-ethyl-1,3-thiazole-2-carboxylate is sourced from PubChem (CID 20775037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).