C27H55NaO17S — CID 20775345
sodium 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl sulfate (PubChem CID 20775345) has the molecular formula C27H55NaO17S and a molecular weight of 706.78 g/mol. Its IUPAC name is sodium 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl sulfate.
| Compound Name | sodium 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl sulfate |
|---|---|
| PubChem CID | 20775345 |
| Molecular Formula | C27H55NaO17S |
| Molecular Weight | 706.78 g/mol |
| Exact Mass | 706.31 |
| IUPAC Name | sodium 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl sulfate |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C27H56O17S.Na/c1-31-2-3-32-4-5-33-6-7-34-8-9-35-10-11-36-12-13-37-14-15-38-16-17-39-18-19-40-20-21-41-22-23-42-24-25-43-26-27-44-45(28,29)30;/h2-27H2,1H3,(H,28,29,30);/q;+1/p-1 |
| InChIKey | HVFNYAAKMVGQQI-UHFFFAOYSA-M |
| XLogP | -3.69 |
| TPSA | 186.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.78 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|