C23H20F3NO3S — CID 20775659
ethyl (Z)-4-(4-phenylmethoxyphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]but-2-enoate (PubChem CID 20775659) has the molecular formula C23H20F3NO3S and a molecular weight of 447.48 g/mol. Its IUPAC name is ethyl (Z)-4-(4-phenylmethoxyphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]but-2-enoate.
| Compound Name | ethyl (Z)-4-(4-phenylmethoxyphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 20775659 |
| Molecular Formula | C23H20F3NO3S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | ethyl (Z)-4-(4-phenylmethoxyphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]but-2-enoate |
| SMILES | CCOC(=O)/C=C(/Cc1ccc(OCc2ccccc2)cc1)c1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C23H20F3NO3S/c1-2-29-21(28)13-18(22-27-20(15-31-22)23(24,25)26)12-16-8-10-19(11-9-16)30-14-17-6-4-3-5-7-17/h3-11,13,15H,2,12,14H2,1H3/b18-13- |
| InChIKey | DDPULHMZUVKVPK-AQTBWJFISA-N |
| XLogP | 5.93 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|