About methyl 4-(4-phenylmethoxyphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butanoate
methyl 4-(4-phenylmethoxyphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butanoate (PubChem CID 20775667) has the molecular formula C22H20F3NO3S
and a molecular weight of 435.47 g/mol. Its IUPAC name is methyl 4-(4-phenylmethoxyphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butanoate.
Molecular Properties
| Compound Name | methyl 4-(4-phenylmethoxyphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butanoate |
| PubChem CID | 20775667 |
| Molecular Formula | C22H20F3NO3S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | methyl 4-(4-phenylmethoxyphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butanoate |
| SMILES | COC(=O)CC(Cc1ccc(OCc2ccccc2)cc1)c1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C22H20F3NO3S/c1-28-20(27)12-17(21-26-19(14-30-21)22(23,24)25)11-15-7-9-18(10-8-15)29-13-16-5-3-2-4-6-16/h2-10,14,17H,11-13H2,1H3 |
| InChIKey | AVNGAOQWEHKFPC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-(4-phenylmethoxyphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(4-phenylmethoxyphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butanoate?
The IUPAC name of methyl 4-(4-phenylmethoxyphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butanoate (CID 20775667) is methyl 4-(4-phenylmethoxyphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butanoate.
What is the SMILES notation for methyl 4-(4-phenylmethoxyphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butanoate?
The canonical SMILES for methyl 4-(4-phenylmethoxyphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butanoate is COC(=O)CC(Cc1ccc(OCc2ccccc2)cc1)c1nc(C(F)(F)F)cs1.
What is the InChIKey of methyl 4-(4-phenylmethoxyphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butanoate?
The InChIKey is AVNGAOQWEHKFPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20F3NO3S/c1-28-20(27)12-17(21-26-19(14-30-21)22(23,24)25)11-15-7-9-18(10-8-15)29-13-16-5-3-2-4-6-16/h2-10,14,17H,11-13H2,1H3.
What are the key properties of methyl 4-(4-phenylmethoxyphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butanoate?
methyl 4-(4-phenylmethoxyphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butanoate has a molecular weight of 435.47 g/mol, XLogP of 5.63, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4-phenylmethoxyphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butanoate is sourced from PubChem (CID 20775667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).