C26H35ClN2O — CID 20776191
2-chloro-5-[3-[methyl(prop-2-enyl)amino]propyl]-N-(1-tetracyclo[5.3.1.03,9.05,9]undecanylmethyl)benzamide (PubChem CID 20776191) has the molecular formula C26H35ClN2O and a molecular weight of 427.03 g/mol. Its IUPAC name is 2-chloro-5-[3-[methyl(prop-2-enyl)amino]propyl]-N-(1-tetracyclo[5.3.1.03,9.05,9]undecanylmethyl)benzamide.
| Compound Name | 2-chloro-5-[3-[methyl(prop-2-enyl)amino]propyl]-N-(1-tetracyclo[5.3.1.03,9.05,9]undecanylmethyl)benzamide |
|---|---|
| PubChem CID | 20776191 |
| Molecular Formula | C26H35ClN2O |
| Molecular Weight | 427.03 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 2-chloro-5-[3-[methyl(prop-2-enyl)amino]propyl]-N-(1-tetracyclo[5.3.1.03,9.05,9]undecanylmethyl)benzamide |
| SMILES | C=CCN(C)CCCc1ccc(Cl)c(C(=O)NCC23CC4CC5CC(C2)C5(C4)C3)c1 |
| InChI | InChI=1S/C26H35ClN2O/c1-3-8-29(2)9-4-5-18-6-7-23(27)22(11-18)24(30)28-17-25-13-19-10-20-12-21(15-25)26(20,14-19)16-25/h3,6-7,11,19-21H,1,4-5,8-10,12-17H2,2H3,(H,28,30) |
| InChIKey | PFOXYIXQGUIDCU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.03 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|