C14H30N2O — CID 20776245
3,5-diethyl-4-methoxy-1,2,2,3,5-pentamethylpiperazine (PubChem CID 20776245) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is 3,5-diethyl-4-methoxy-1,2,2,3,5-pentamethylpiperazine.
| Compound Name | 3,5-diethyl-4-methoxy-1,2,2,3,5-pentamethylpiperazine |
|---|---|
| PubChem CID | 20776245 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 3,5-diethyl-4-methoxy-1,2,2,3,5-pentamethylpiperazine |
| SMILES | CCC1(C)CN(C)C(C)(C)C(C)(CC)N1OC |
| InChI | InChI=1S/C14H30N2O/c1-9-13(5)11-15(7)12(3,4)14(6,10-2)16(13)17-8/h9-11H2,1-8H3 |
| InChIKey | UXXGCCGRKVVYSV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |