C17H37N3 — CID 20776250
N'-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)-N,N,N'-trimethylmethanediamine (PubChem CID 20776250) has the molecular formula C17H37N3 and a molecular weight of 283.50 g/mol. Its IUPAC name is N'-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)-N,N,N'-trimethylmethanediamine.
| Compound Name | N'-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)-N,N,N'-trimethylmethanediamine |
|---|---|
| PubChem CID | 20776250 |
| Molecular Formula | C17H37N3 |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.30 |
| IUPAC Name | N'-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)-N,N,N'-trimethylmethanediamine |
| SMILES | CCC1(C)CC(N(C)CN(C)C)C(C)C(C)(CC)N1C |
| InChI | InChI=1S/C17H37N3/c1-10-16(4)12-15(19(8)13-18(6)7)14(3)17(5,11-2)20(16)9/h14-15H,10-13H2,1-9H3 |
| InChIKey | BCRTXFGBHGORBK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|