C41H46F6O2S2 — CID 20776475
2-[4-(2,3-dimethylbutan-2-yloxy)phenyl]-4-[2-[5-[4-(2,3-dimethylbutan-2-yloxy)phenyl]-2,4-dimethylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethylthiophene (PubChem CID 20776475) has the molecular formula C41H46F6O2S2 and a molecular weight of 748.94 g/mol. Its IUPAC name is 2-[4-(2,3-dimethylbutan-2-yloxy)phenyl]-4-[2-[5-[4-(2,3-dimethylbutan-2-yloxy)phenyl]-2,4-dimethylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethylthiophene.
| Compound Name | 2-[4-(2,3-dimethylbutan-2-yloxy)phenyl]-4-[2-[5-[4-(2,3-dimethylbutan-2-yloxy)phenyl]-2,4-dimethylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethylthiophene |
|---|---|
| PubChem CID | 20776475 |
| Molecular Formula | C41H46F6O2S2 |
| Molecular Weight | 748.94 g/mol |
| Exact Mass | 748.28 |
| IUPAC Name | 2-[4-(2,3-dimethylbutan-2-yloxy)phenyl]-4-[2-[5-[4-(2,3-dimethylbutan-2-yloxy)phenyl]-2,4-dimethylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethylthiophene |
| SMILES | Cc1sc(-c2ccc(OC(C)(C)C(C)C)cc2)c(C)c1C1=C(c2c(C)sc(-c3ccc(OC(C)(C)C(C)C)cc3)c2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C41H46F6O2S2/c1-21(2)37(9,10)48-29-17-13-27(14-18-29)35-23(5)31(25(7)50-35)33-34(40(44,45)41(46,47)39(33,42)43)32-24(6)36(51-26(32)8)28-15-19-30(20-16-28)49-38(11,12)22(3)4/h13-22H,1-12H3 |
| InChIKey | JNRGUQJUUBBPPN-UHFFFAOYSA-N |
| XLogP | 13.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.94 |
| LogP ≤ 5 | 13.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|