C34H37F6N5O6S — CID 20776757
ethyl 4-[2-[4-[4-(4-methylcyclohexyl)piperazin-1-yl]phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]benzoate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 20776757) has the molecular formula C34H37F6N5O6S and a molecular weight of 757.75 g/mol. Its IUPAC name is ethyl 4-[2-[4-[4-(4-methylcyclohexyl)piperazin-1-yl]phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]benzoate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | ethyl 4-[2-[4-[4-(4-methylcyclohexyl)piperazin-1-yl]phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]benzoate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 20776757 |
| Molecular Formula | C34H37F6N5O6S |
| Molecular Weight | 757.75 g/mol |
| Exact Mass | 757.24 |
| IUPAC Name | ethyl 4-[2-[4-[4-(4-methylcyclohexyl)piperazin-1-yl]phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]benzoate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCOC(=O)c1ccc(-c2cn3nc(-c4ccc(N5CCN(C6CCC(C)CC6)CC5)cc4)sc3n2)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H35N5O2S.2C2HF3O2/c1-3-37-29(36)24-8-6-22(7-9-24)27-20-35-30(31-27)38-28(32-35)23-10-14-26(15-11-23)34-18-16-33(17-19-34)25-12-4-21(2)5-13-25;2*3-2(4,5)1(6)7/h6-11,14-15,20-21,25H,3-5,12-13,16-19H2,1-2H3;2*(H,6,7) |
| InChIKey | DXTHPMDIVSCWDO-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.75 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |