C11H15N3 — CID 20777190
2-ethyl-3-propylimidazo[4,5-b]pyridine (PubChem CID 20777190) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-ethyl-3-propylimidazo[4,5-b]pyridine.
| Compound Name | 2-ethyl-3-propylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 20777190 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 2-ethyl-3-propylimidazo[4,5-b]pyridine |
| SMILES | CCCn1c(CC)nc2cccnc21 |
| InChI | InChI=1S/C11H15N3/c1-3-8-14-10(4-2)13-9-6-5-7-12-11(9)14/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | VYYJIPUXXPVHNM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |