C24H24N4O — CID 20778085
N-[3-[methyl-[3-(2-phenylethyl)-2H-indazol-6-yl]amino]phenyl]acetamide (PubChem CID 20778085) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[3-[methyl-[3-(2-phenylethyl)-2H-indazol-6-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[methyl-[3-(2-phenylethyl)-2H-indazol-6-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 20778085 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-[3-[methyl-[3-(2-phenylethyl)-2H-indazol-6-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(N(C)c2ccc3c(CCc4ccccc4)[nH]nc3c2)c1 |
| InChI | InChI=1S/C24H24N4O/c1-17(29)25-19-9-6-10-20(15-19)28(2)21-12-13-22-23(26-27-24(22)16-21)14-11-18-7-4-3-5-8-18/h3-10,12-13,15-16H,11,14H2,1-2H3,(H,25,29)(H,26,27) |
| InChIKey | DSRCUYSBOUZCJR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |