C29H16F6N2S4 — CID 20778256
2-[4-[2-[5-(1,3-benzothiazol-2-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-1,3-benzothiazole (PubChem CID 20778256) has the molecular formula C29H16F6N2S4 and a molecular weight of 634.72 g/mol. Its IUPAC name is 2-[4-[2-[5-(1,3-benzothiazol-2-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[4-[2-[5-(1,3-benzothiazol-2-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 20778256 |
| Molecular Formula | C29H16F6N2S4 |
| Molecular Weight | 634.72 g/mol |
| Exact Mass | 634.01 |
| IUPAC Name | 2-[4-[2-[5-(1,3-benzothiazol-2-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-1,3-benzothiazole |
| SMILES | Cc1sc(-c2nc3ccccc3s2)cc1C1=C(c2cc(-c3nc4ccccc4s3)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C29H16F6N2S4/c1-13-15(11-21(38-13)25-36-17-7-3-5-9-19(17)40-25)23-24(28(32,33)29(34,35)27(23,30)31)16-12-22(39-14(16)2)26-37-18-8-4-6-10-20(18)41-26/h3-12H,1-2H3 |
| InChIKey | XZNHLICPFSFNFG-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.72 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|