C47H32F6N2S2 — CID 20778258
3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-6-(N-phenylanilino)-1-benzothiophen-3-yl]cyclopenten-1-yl]-2-methyl-N,N-diphenyl-1-benzothiophen-6-amine (PubChem CID 20778258) has the molecular formula C47H32F6N2S2 and a molecular weight of 802.91 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-6-(N-phenylanilino)-1-benzothiophen-3-yl]cyclopenten-1-yl]-2-methyl-N,N-diphenyl-1-benzothiophen-6-amine.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-6-(N-phenylanilino)-1-benzothiophen-3-yl]cyclopenten-1-yl]-2-methyl-N,N-diphenyl-1-benzothiophen-6-amine |
|---|---|
| PubChem CID | 20778258 |
| Molecular Formula | C47H32F6N2S2 |
| Molecular Weight | 802.91 g/mol |
| Exact Mass | 802.19 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-6-(N-phenylanilino)-1-benzothiophen-3-yl]cyclopenten-1-yl]-2-methyl-N,N-diphenyl-1-benzothiophen-6-amine |
| SMILES | Cc1sc2cc(N(c3ccccc3)c3ccccc3)ccc2c1C1=C(c2c(C)sc3cc(N(c4ccccc4)c4ccccc4)ccc23)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C47H32F6N2S2/c1-29-41(37-25-23-35(27-39(37)56-29)54(31-15-7-3-8-16-31)32-17-9-4-10-18-32)43-44(46(50,51)47(52,53)45(43,48)49)42-30(2)57-40-28-36(24-26-38(40)42)55(33-19-11-5-12-20-33)34-21-13-6-14-22-34/h3-28H,1-2H3 |
| InChIKey | NLWYZPPBLNMALN-UHFFFAOYSA-N |
| XLogP | 15.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.91 |
| LogP ≤ 5 | 15.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|