C49H31F6N3OS2 — CID 20778259
3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-6-[5-(4-phenylphenyl)-1,3,4-oxadiazol-2-yl]-1-benzothiophen-3-yl]cyclopenten-1-yl]-2-methyl-N,N-diphenyl-1-benzothiophen-6-amine (PubChem CID 20778259) has the molecular formula C49H31F6N3OS2 and a molecular weight of 855.93 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-6-[5-(4-phenylphenyl)-1,3,4-oxadiazol-2-yl]-1-benzothiophen-3-yl]cyclopenten-1-yl]-2-methyl-N,N-diphenyl-1-benzothiophen-6-amine.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-6-[5-(4-phenylphenyl)-1,3,4-oxadiazol-2-yl]-1-benzothiophen-3-yl]cyclopenten-1-yl]-2-methyl-N,N-diphenyl-1-benzothiophen-6-amine |
|---|---|
| PubChem CID | 20778259 |
| Molecular Formula | C49H31F6N3OS2 |
| Molecular Weight | 855.93 g/mol |
| Exact Mass | 855.18 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-6-[5-(4-phenylphenyl)-1,3,4-oxadiazol-2-yl]-1-benzothiophen-3-yl]cyclopenten-1-yl]-2-methyl-N,N-diphenyl-1-benzothiophen-6-amine |
| SMILES | Cc1sc2cc(-c3nnc(-c4ccc(-c5ccccc5)cc4)o3)ccc2c1C1=C(c2c(C)sc3cc(N(c4ccccc4)c4ccccc4)ccc23)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C49H31F6N3OS2/c1-28-41(37-24-22-33(26-39(37)60-28)46-57-56-45(59-46)32-20-18-31(19-21-32)30-12-6-3-7-13-30)43-44(48(52,53)49(54,55)47(43,50)51)42-29(2)61-40-27-36(23-25-38(40)42)58(34-14-8-4-9-15-34)35-16-10-5-11-17-35/h3-27H,1-2H3 |
| InChIKey | UVVXJNJWXFJJHV-UHFFFAOYSA-N |
| XLogP | 15.42 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.93 |
| LogP ≤ 5 | 15.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|