About 5-(dimethylsulfamoyl)-1,3,4-thiadiazole-2-carboxamide
5-(dimethylsulfamoyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 20778422) has the molecular formula C5H8N4O3S2
and a molecular weight of 236.28 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-1,3,4-thiadiazole-2-carboxamide.
Molecular Properties
| Compound Name | 5-(dimethylsulfamoyl)-1,3,4-thiadiazole-2-carboxamide |
| PubChem CID | 20778422 |
| Molecular Formula | C5H8N4O3S2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | 5-(dimethylsulfamoyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1nnc(C(N)=O)s1 |
| InChI | InChI=1S/C5H8N4O3S2/c1-9(2)14(11,12)5-8-7-4(13-5)3(6)10/h1-2H3,(H2,6,10) |
| InChIKey | WLNVHIFOSSCAGZ-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(dimethylsulfamoyl)-1,3,4-thiadiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylsulfamoyl)-1,3,4-thiadiazole-2-carboxamide?
The IUPAC name of 5-(dimethylsulfamoyl)-1,3,4-thiadiazole-2-carboxamide (CID 20778422) is 5-(dimethylsulfamoyl)-1,3,4-thiadiazole-2-carboxamide.
What is the SMILES notation for 5-(dimethylsulfamoyl)-1,3,4-thiadiazole-2-carboxamide?
The canonical SMILES for 5-(dimethylsulfamoyl)-1,3,4-thiadiazole-2-carboxamide is CN(C)S(=O)(=O)c1nnc(C(N)=O)s1.
What is the InChIKey of 5-(dimethylsulfamoyl)-1,3,4-thiadiazole-2-carboxamide?
The InChIKey is WLNVHIFOSSCAGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O3S2/c1-9(2)14(11,12)5-8-7-4(13-5)3(6)10/h1-2H3,(H2,6,10).
What are the key properties of 5-(dimethylsulfamoyl)-1,3,4-thiadiazole-2-carboxamide?
5-(dimethylsulfamoyl)-1,3,4-thiadiazole-2-carboxamide has a molecular weight of 236.28 g/mol, XLogP of -1.11, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylsulfamoyl)-1,3,4-thiadiazole-2-carboxamide is sourced from PubChem (CID 20778422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).