C30H50O6 — CID 20778488
[2-[4-(4-hexoxy-2-methyl-4-oxobutan-2-yl)-2,5-dimethoxyphenyl]-2-methylpropyl] heptanoate (PubChem CID 20778488) has the molecular formula C30H50O6 and a molecular weight of 506.72 g/mol. Its IUPAC name is [2-[4-(4-hexoxy-2-methyl-4-oxobutan-2-yl)-2,5-dimethoxyphenyl]-2-methylpropyl] heptanoate.
| Compound Name | [2-[4-(4-hexoxy-2-methyl-4-oxobutan-2-yl)-2,5-dimethoxyphenyl]-2-methylpropyl] heptanoate |
|---|---|
| PubChem CID | 20778488 |
| Molecular Formula | C30H50O6 |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | [2-[4-(4-hexoxy-2-methyl-4-oxobutan-2-yl)-2,5-dimethoxyphenyl]-2-methylpropyl] heptanoate |
| SMILES | CCCCCCOC(=O)CC(C)(C)c1cc(OC)c(C(C)(C)COC(=O)CCCCCC)cc1OC |
| InChI | InChI=1S/C30H50O6/c1-9-11-13-15-17-27(31)36-22-30(5,6)24-20-25(33-7)23(19-26(24)34-8)29(3,4)21-28(32)35-18-16-14-12-10-2/h19-20H,9-18,21-22H2,1-8H3 |
| InChIKey | GTKZDRZGHVVHGF-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|