C34H46N4O7S2 — CID 20778524
2-[2-(3-butoxypropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-N-[2-(2,2-dimethylpropylsulfanyl)-5-ethylphenyl]acetamide (PubChem CID 20778524) has the molecular formula C34H46N4O7S2 and a molecular weight of 686.90 g/mol. Its IUPAC name is 2-[2-(3-butoxypropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-N-[2-(2,2-dimethylpropylsulfanyl)-5-ethylphenyl]acetamide.
| Compound Name | 2-[2-(3-butoxypropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-N-[2-(2,2-dimethylpropylsulfanyl)-5-ethylphenyl]acetamide |
|---|---|
| PubChem CID | 20778524 |
| Molecular Formula | C34H46N4O7S2 |
| Molecular Weight | 686.90 g/mol |
| Exact Mass | 686.28 |
| IUPAC Name | 2-[2-(3-butoxypropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-N-[2-(2,2-dimethylpropylsulfanyl)-5-ethylphenyl]acetamide |
| SMILES | CCCCOCCCN1C(C(C(=O)Nc2cc(CC)ccc2SCC(C)(C)C)N2C(=O)OC(C)(C)C2=O)=Nc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C34H46N4O7S2/c1-8-10-19-44-20-13-18-37-29(35-24-14-11-12-15-27(24)47(37,42)43)28(38-31(40)34(6,7)45-32(38)41)30(39)36-25-21-23(9-2)16-17-26(25)46-22-33(3,4)5/h11-12,14-17,21,28H,8-10,13,18-20,22H2,1-7H3,(H,36,39) |
| InChIKey | MCSSBIKTBRHNHE-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.90 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|