About 2-methylsulfanylethyl propanoate
2-methylsulfanylethyl propanoate (PubChem CID 20778549) has the molecular formula C6H12O2S
and a molecular weight of 148.23 g/mol. Its IUPAC name is 2-methylsulfanylethyl propanoate.
Molecular Properties
| Compound Name | 2-methylsulfanylethyl propanoate |
| PubChem CID | 20778549 |
| Molecular Formula | C6H12O2S |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 2-methylsulfanylethyl propanoate |
| SMILES | CCC(=O)OCCSC |
| InChI | InChI=1S/C6H12O2S/c1-3-6(7)8-4-5-9-2/h3-5H2,1-2H3 |
| InChIKey | DKKXORTWZSTSJB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfanylethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanylethyl propanoate?
The IUPAC name of 2-methylsulfanylethyl propanoate (CID 20778549) is 2-methylsulfanylethyl propanoate.
What is the SMILES notation for 2-methylsulfanylethyl propanoate?
The canonical SMILES for 2-methylsulfanylethyl propanoate is CCC(=O)OCCSC.
What is the InChIKey of 2-methylsulfanylethyl propanoate?
The InChIKey is DKKXORTWZSTSJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2S/c1-3-6(7)8-4-5-9-2/h3-5H2,1-2H3.
What are the key properties of 2-methylsulfanylethyl propanoate?
2-methylsulfanylethyl propanoate has a molecular weight of 148.23 g/mol, XLogP of 1.30, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylethyl propanoate is sourced from PubChem (CID 20778549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).