About 1,8a-dihydroimidazo[1,5-a]pyridine
1,8a-dihydroimidazo[1,5-a]pyridine (PubChem CID 20778855) has the molecular formula C7H8N2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 1,8a-dihydroimidazo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 1,8a-dihydroimidazo[1,5-a]pyridine |
| PubChem CID | 20778855 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 1,8a-dihydroimidazo[1,5-a]pyridine |
| SMILES | C1=CC2CN=CN2C=C1 |
| InChI | InChI=1S/C7H8N2/c1-2-4-9-6-8-5-7(9)3-1/h1-4,6-7H,5H2 |
| InChIKey | VWPZTACYKVISPF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,8a-dihydroimidazo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8a-dihydroimidazo[1,5-a]pyridine?
The IUPAC name of 1,8a-dihydroimidazo[1,5-a]pyridine (CID 20778855) is 1,8a-dihydroimidazo[1,5-a]pyridine.
What is the SMILES notation for 1,8a-dihydroimidazo[1,5-a]pyridine?
The canonical SMILES for 1,8a-dihydroimidazo[1,5-a]pyridine is C1=CC2CN=CN2C=C1.
What is the InChIKey of 1,8a-dihydroimidazo[1,5-a]pyridine?
The InChIKey is VWPZTACYKVISPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2/c1-2-4-9-6-8-5-7(9)3-1/h1-4,6-7H,5H2.
What are the key properties of 1,8a-dihydroimidazo[1,5-a]pyridine?
1,8a-dihydroimidazo[1,5-a]pyridine has a molecular weight of 120.15 g/mol, XLogP of 0.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8a-dihydroimidazo[1,5-a]pyridine is sourced from PubChem (CID 20778855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).