C39H54N2 — CID 20779707
1-N,2-N,3-trimethyl-6-(7-methyl-9,9-dioctylfluoren-2-yl)cyclohexa-3,5-diene-1,2-diimine (PubChem CID 20779707) has the molecular formula C39H54N2 and a molecular weight of 550.88 g/mol. Its IUPAC name is 1-N,2-N,3-trimethyl-6-(7-methyl-9,9-dioctylfluoren-2-yl)cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 1-N,2-N,3-trimethyl-6-(7-methyl-9,9-dioctylfluoren-2-yl)cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 20779707 |
| Molecular Formula | C39H54N2 |
| Molecular Weight | 550.88 g/mol |
| Exact Mass | 550.43 |
| IUPAC Name | 1-N,2-N,3-trimethyl-6-(7-methyl-9,9-dioctylfluoren-2-yl)cyclohexa-3,5-diene-1,2-diimine |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2ccc(C3=CC=C(C)C(=N\C)/C3=N\C)cc21 |
| InChI | InChI=1S/C39H54N2/c1-7-9-11-13-15-17-25-39(26-18-16-14-12-10-8-2)35-27-29(3)19-22-33(35)34-24-21-31(28-36(34)39)32-23-20-30(4)37(40-5)38(32)41-6/h19-24,27-28H,7-18,25-26H2,1-6H3/b40-37+,41-38- |
| InChIKey | BQXZPEOBMPBDMI-MKSJHFOFSA-N |
| XLogP | 11.25 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.88 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|