C21H13ClF3N3O2 — CID 20779873
2-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 20779873) has the molecular formula C21H13ClF3N3O2 and a molecular weight of 431.80 g/mol. Its IUPAC name is 2-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 20779873 |
| Molecular Formula | C21H13ClF3N3O2 |
| Molecular Weight | 431.80 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 2-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | O=C1NCCn2c(-c3ccc(-c4cc(C(F)(F)F)ccc4Cl)o3)nc3cccc1c32 |
| InChI | InChI=1S/C21H13ClF3N3O2/c22-14-5-4-11(21(23,24)25)10-13(14)16-6-7-17(30-16)19-27-15-3-1-2-12-18(15)28(19)9-8-26-20(12)29/h1-7,10H,8-9H2,(H,26,29) |
| InChIKey | HYFQODDGLCXCKO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.80 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |