C15H11N3O4 — CID 20779874
5-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)furan-2-carboxylic acid (PubChem CID 20779874) has the molecular formula C15H11N3O4 and a molecular weight of 297.27 g/mol. Its IUPAC name is 5-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)furan-2-carboxylic acid.
| Compound Name | 5-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 20779874 |
| Molecular Formula | C15H11N3O4 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 5-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2nc3cccc4c3n2CCNC4=O)o1 |
| InChI | InChI=1S/C15H11N3O4/c19-14-8-2-1-3-9-12(8)18(7-6-16-14)13(17-9)10-4-5-11(22-10)15(20)21/h1-5H,6-7H2,(H,16,19)(H,20,21) |
| InChIKey | WPDUMKWMAANNJU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |