C24H26N4O4 — CID 20779918
methyl 3-(4-methylphenyl)-2-[3-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)propanoylamino]propanoate (PubChem CID 20779918) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is methyl 3-(4-methylphenyl)-2-[3-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)propanoylamino]propanoate.
| Compound Name | methyl 3-(4-methylphenyl)-2-[3-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)propanoylamino]propanoate |
|---|---|
| PubChem CID | 20779918 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | methyl 3-(4-methylphenyl)-2-[3-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)propanoylamino]propanoate |
| SMILES | COC(=O)C(Cc1ccc(C)cc1)NC(=O)CCc1nc2cccc3c2n1CCNC3=O |
| InChI | InChI=1S/C24H26N4O4/c1-15-6-8-16(9-7-15)14-19(24(31)32-2)27-21(29)11-10-20-26-18-5-3-4-17-22(18)28(20)13-12-25-23(17)30/h3-9,19H,10-14H2,1-2H3,(H,25,30)(H,27,29) |
| InChIKey | VMXOSIYRNMJNEY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |