C22H29F3N4O — CID 20780037
6-ethyl-N-propyl-N-(2,2,2-trifluoroethyl)-1-(2,4,6-trimethylphenyl)-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxamide (PubChem CID 20780037) has the molecular formula C22H29F3N4O and a molecular weight of 422.50 g/mol. Its IUPAC name is 6-ethyl-N-propyl-N-(2,2,2-trifluoroethyl)-1-(2,4,6-trimethylphenyl)-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxamide.
| Compound Name | 6-ethyl-N-propyl-N-(2,2,2-trifluoroethyl)-1-(2,4,6-trimethylphenyl)-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxamide |
|---|---|
| PubChem CID | 20780037 |
| Molecular Formula | C22H29F3N4O |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 6-ethyl-N-propyl-N-(2,2,2-trifluoroethyl)-1-(2,4,6-trimethylphenyl)-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxamide |
| SMILES | CCCN(CC(F)(F)F)C(=O)c1c(CC)nc2n1CCN2c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C22H29F3N4O/c1-6-8-27(13-22(23,24)25)20(30)19-17(7-2)26-21-28(9-10-29(19)21)18-15(4)11-14(3)12-16(18)5/h11-12H,6-10,13H2,1-5H3 |
| InChIKey | LQEITOXZZODRDN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |