C27H28F6N4 — CID 20780074
N-(cyclopropylmethyl)-3,3,3-trifluoro-N-[[2-(trifluoromethyl)-4-(2,4,6-trimethylphenyl)imidazo[1,2-a]benzimidazol-1-yl]methyl]propan-1-amine (PubChem CID 20780074) has the molecular formula C27H28F6N4 and a molecular weight of 522.54 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-3,3,3-trifluoro-N-[[2-(trifluoromethyl)-4-(2,4,6-trimethylphenyl)imidazo[1,2-a]benzimidazol-1-yl]methyl]propan-1-amine.
| Compound Name | N-(cyclopropylmethyl)-3,3,3-trifluoro-N-[[2-(trifluoromethyl)-4-(2,4,6-trimethylphenyl)imidazo[1,2-a]benzimidazol-1-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 20780074 |
| Molecular Formula | C27H28F6N4 |
| Molecular Weight | 522.54 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | N-(cyclopropylmethyl)-3,3,3-trifluoro-N-[[2-(trifluoromethyl)-4-(2,4,6-trimethylphenyl)imidazo[1,2-a]benzimidazol-1-yl]methyl]propan-1-amine |
| SMILES | Cc1cc(C)c(-n2c3ccccc3n3c(CN(CCC(F)(F)F)CC4CC4)c(C(F)(F)F)nc23)c(C)c1 |
| InChI | InChI=1S/C27H28F6N4/c1-16-12-17(2)23(18(3)13-16)37-21-7-5-4-6-20(21)36-22(24(27(31,32)33)34-25(36)37)15-35(14-19-8-9-19)11-10-26(28,29)30/h4-7,12-13,19H,8-11,14-15H2,1-3H3 |
| InChIKey | IAPBVJCDTHIXQJ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 25.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.54 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |