About ethyl 1-(2-bromo-4-propan-2-ylphenyl)-6-ethyl-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxylate
ethyl 1-(2-bromo-4-propan-2-ylphenyl)-6-ethyl-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxylate (PubChem CID 20780229) has the molecular formula C19H24BrN3O2
and a molecular weight of 406.32 g/mol. Its IUPAC name is ethyl 1-(2-bromo-4-propan-2-ylphenyl)-6-ethyl-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(2-bromo-4-propan-2-ylphenyl)-6-ethyl-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxylate |
| PubChem CID | 20780229 |
| Molecular Formula | C19H24BrN3O2 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | ethyl 1-(2-bromo-4-propan-2-ylphenyl)-6-ethyl-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxylate |
| SMILES | CCOC(=O)c1c(CC)nc2n1CCN2c1ccc(C(C)C)cc1Br |
| InChI | InChI=1S/C19H24BrN3O2/c1-5-15-17(18(24)25-6-2)23-10-9-22(19(23)21-15)16-8-7-13(12(3)4)11-14(16)20/h7-8,11-12H,5-6,9-10H2,1-4H3 |
| InChIKey | ADOYIMJMJBWVRW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-(2-bromo-4-propan-2-ylphenyl)-6-ethyl-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(2-bromo-4-propan-2-ylphenyl)-6-ethyl-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxylate?
The IUPAC name of ethyl 1-(2-bromo-4-propan-2-ylphenyl)-6-ethyl-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxylate (CID 20780229) is ethyl 1-(2-bromo-4-propan-2-ylphenyl)-6-ethyl-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxylate.
What is the SMILES notation for ethyl 1-(2-bromo-4-propan-2-ylphenyl)-6-ethyl-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxylate?
The canonical SMILES for ethyl 1-(2-bromo-4-propan-2-ylphenyl)-6-ethyl-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxylate is CCOC(=O)c1c(CC)nc2n1CCN2c1ccc(C(C)C)cc1Br.
What is the InChIKey of ethyl 1-(2-bromo-4-propan-2-ylphenyl)-6-ethyl-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxylate?
The InChIKey is ADOYIMJMJBWVRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24BrN3O2/c1-5-15-17(18(24)25-6-2)23-10-9-22(19(23)21-15)16-8-7-13(12(3)4)11-14(16)20/h7-8,11-12H,5-6,9-10H2,1-4H3.
What are the key properties of ethyl 1-(2-bromo-4-propan-2-ylphenyl)-6-ethyl-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxylate?
ethyl 1-(2-bromo-4-propan-2-ylphenyl)-6-ethyl-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxylate has a molecular weight of 406.32 g/mol, XLogP of 4.66, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(2-bromo-4-propan-2-ylphenyl)-6-ethyl-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxylate is sourced from PubChem (CID 20780229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).