C24H22N2O3 — CID 20781098
9-benzyl-1-(furan-2-yl)-6-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 20781098) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is 9-benzyl-1-(furan-2-yl)-6-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | 9-benzyl-1-(furan-2-yl)-6-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 20781098 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 9-benzyl-1-(furan-2-yl)-6-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | Cc1ccc2c(c1)c1c(n2Cc2ccccc2)C(c2ccco2)NC(C(=O)O)C1 |
| InChI | InChI=1S/C24H22N2O3/c1-15-9-10-20-17(12-15)18-13-19(24(27)28)25-22(21-8-5-11-29-21)23(18)26(20)14-16-6-3-2-4-7-16/h2-12,19,22,25H,13-14H2,1H3,(H,27,28) |
| InChIKey | WNYBNYKOPYNZPZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|