C11H18F8O2Si — CID 20781314
methoxy-dimethyl-[3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl]silane (PubChem CID 20781314) has the molecular formula C11H18F8O2Si and a molecular weight of 362.33 g/mol. Its IUPAC name is methoxy-dimethyl-[3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl]silane.
| Compound Name | methoxy-dimethyl-[3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl]silane |
|---|---|
| PubChem CID | 20781314 |
| Molecular Formula | C11H18F8O2Si |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | methoxy-dimethyl-[3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl]silane |
| SMILES | CO[Si](C)(C)CCCOCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H18F8O2Si/c1-20-22(2,3)6-4-5-21-7-9(14,15)11(18,19)10(16,17)8(12)13/h8H,4-7H2,1-3H3 |
| InChIKey | NLVLYBAKGVKRBC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|