About 2-butan-2-yl-4,4-dimethyl-1,3-oxazol-5-one
2-butan-2-yl-4,4-dimethyl-1,3-oxazol-5-one (PubChem CID 20781541) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is 2-butan-2-yl-4,4-dimethyl-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | 2-butan-2-yl-4,4-dimethyl-1,3-oxazol-5-one |
| PubChem CID | 20781541 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 2-butan-2-yl-4,4-dimethyl-1,3-oxazol-5-one |
| SMILES | CCC(C)C1=NC(C)(C)C(=O)O1 |
| InChI | InChI=1S/C9H15NO2/c1-5-6(2)7-10-9(3,4)8(11)12-7/h6H,5H2,1-4H3 |
| InChIKey | OFWXGBOHNGNENG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butan-2-yl-4,4-dimethyl-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-4,4-dimethyl-1,3-oxazol-5-one?
The IUPAC name of 2-butan-2-yl-4,4-dimethyl-1,3-oxazol-5-one (CID 20781541) is 2-butan-2-yl-4,4-dimethyl-1,3-oxazol-5-one.
What is the SMILES notation for 2-butan-2-yl-4,4-dimethyl-1,3-oxazol-5-one?
The canonical SMILES for 2-butan-2-yl-4,4-dimethyl-1,3-oxazol-5-one is CCC(C)C1=NC(C)(C)C(=O)O1.
What is the InChIKey of 2-butan-2-yl-4,4-dimethyl-1,3-oxazol-5-one?
The InChIKey is OFWXGBOHNGNENG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-5-6(2)7-10-9(3,4)8(11)12-7/h6H,5H2,1-4H3.
What are the key properties of 2-butan-2-yl-4,4-dimethyl-1,3-oxazol-5-one?
2-butan-2-yl-4,4-dimethyl-1,3-oxazol-5-one has a molecular weight of 169.22 g/mol, XLogP of 1.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-4,4-dimethyl-1,3-oxazol-5-one is sourced from PubChem (CID 20781541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).