About 2,8,10-trimethylphenoxazine
2,8,10-trimethylphenoxazine (PubChem CID 20781562) has the molecular formula C15H15NO
and a molecular weight of 225.29 g/mol. Its IUPAC name is 2,8,10-trimethylphenoxazine.
Molecular Properties
| Compound Name | 2,8,10-trimethylphenoxazine |
| PubChem CID | 20781562 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2,8,10-trimethylphenoxazine |
| SMILES | Cc1ccc2c(c1)N(C)c1cc(C)ccc1O2 |
| InChI | InChI=1S/C15H15NO/c1-10-4-6-14-12(8-10)16(3)13-9-11(2)5-7-15(13)17-14/h4-9H,1-3H3 |
| InChIKey | ILBDUPLYJZDYSA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,8,10-trimethylphenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8,10-trimethylphenoxazine?
The IUPAC name of 2,8,10-trimethylphenoxazine (CID 20781562) is 2,8,10-trimethylphenoxazine.
What is the SMILES notation for 2,8,10-trimethylphenoxazine?
The canonical SMILES for 2,8,10-trimethylphenoxazine is Cc1ccc2c(c1)N(C)c1cc(C)ccc1O2.
What is the InChIKey of 2,8,10-trimethylphenoxazine?
The InChIKey is ILBDUPLYJZDYSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO/c1-10-4-6-14-12(8-10)16(3)13-9-11(2)5-7-15(13)17-14/h4-9H,1-3H3.
What are the key properties of 2,8,10-trimethylphenoxazine?
2,8,10-trimethylphenoxazine has a molecular weight of 225.29 g/mol, XLogP of 4.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8,10-trimethylphenoxazine is sourced from PubChem (CID 20781562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).