C32H40N4 — CID 20781680
(9Z,19Z)-2,7,12,17-tetraethyl-3,8,13,18-tetramethyl-1,11,22,24-tetrahydroporphyrin (PubChem CID 20781680) has the molecular formula C32H40N4 and a molecular weight of 480.70 g/mol. Its IUPAC name is (9Z,19Z)-2,7,12,17-tetraethyl-3,8,13,18-tetramethyl-1,11,22,24-tetrahydroporphyrin.
| Compound Name | (9Z,19Z)-2,7,12,17-tetraethyl-3,8,13,18-tetramethyl-1,11,22,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 20781680 |
| Molecular Formula | C32H40N4 |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.33 |
| IUPAC Name | (9Z,19Z)-2,7,12,17-tetraethyl-3,8,13,18-tetramethyl-1,11,22,24-tetrahydroporphyrin |
| SMILES | CCC1=C(C)C2=NC1/C=c1\[nH]c(c(CC)c1C)=CC1=NC(/C=c3\[nH]c(c(CC)c3C)=C2)C(CC)=C1C |
| InChI | InChI=1S/C32H40N4/c1-9-21-17(5)25-14-30-23(11-3)19(7)27(35-30)16-32-24(12-4)20(8)28(36-32)15-31-22(10-2)18(6)26(34-31)13-29(21)33-25/h13-16,29,32,34-35H,9-12H2,1-8H3/b26-13-,27-16-,30-14?,31-15? |
| InChIKey | SJPTUNNRVJVDDH-LMRYUAJTSA-N |
| XLogP | 4.02 |
| TPSA | 56.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |