About CID 20781690
CID 20781690 (PubChem CID 20781690) has the molecular formula C28H22Al2N4O3
and a molecular weight of 516.47 g/mol.
Molecular Properties
| Compound Name | CID 20781690 |
| PubChem CID | 20781690 |
| Molecular Formula | C28H22Al2N4O3 |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | — |
| SMILES | Cn1c(-c2ccccc2O[Al]O[Al]Oc2ccccc2-c2nc3ccccc3n2C)nc2ccccc21 |
| InChI | InChI=1S/2C14H12N2O.2Al.O/c2*1-16-12-8-4-3-7-11(12)15-14(16)10-6-2-5-9-13(10)17;;;/h2*2-9,17H,1H3;;;/q;;2*+1;/p-2 |
| InChIKey | XBRQKNUOGUYZOV-UHFFFAOYSA-L |
| XLogP | 5.34 |
| TPSA | 63.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 20781690 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20781690?
The IUPAC name of CID 20781690 (CID 20781690) is not available.
What is the SMILES notation for CID 20781690?
The canonical SMILES for CID 20781690 is Cn1c(-c2ccccc2O[Al]O[Al]Oc2ccccc2-c2nc3ccccc3n2C)nc2ccccc21.
What is the InChIKey of CID 20781690?
The InChIKey is XBRQKNUOGUYZOV-UHFFFAOYSA-L. The full InChI is InChI=1S/2C14H12N2O.2Al.O/c2*1-16-12-8-4-3-7-11(12)15-14(16)10-6-2-5-9-13(10)17;;;/h2*2-9,17H,1H3;;;/q;;2*+1;/p-2.
What are the key properties of CID 20781690?
CID 20781690 has a molecular weight of 516.47 g/mol, XLogP of 5.34, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20781690 is sourced from PubChem (CID 20781690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).