C21H28N2O3 — CID 20782057
[3-oxo-2-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-1-yl] 2,2-dimethylpropanoate (PubChem CID 20782057) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is [3-oxo-2-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [3-oxo-2-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 20782057 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | [3-oxo-2-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-1-yl] 2,2-dimethylpropanoate |
| SMILES | Cc1cc(C)c(-c2c(OC(=O)C(C)(C)C)n3n(c2=O)CCCC3)c(C)c1 |
| InChI | InChI=1S/C21H28N2O3/c1-13-11-14(2)16(15(3)12-13)17-18(24)22-9-7-8-10-23(22)19(17)26-20(25)21(4,5)6/h11-12H,7-10H2,1-6H3 |
| InChIKey | MKJVYOCSJAMLKR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |