C25H28ClNO2 — CID 20782550
4-[(E)-2-[5-(2-chlorophenyl)-2-pyridinyl]ethenyl]-5-ethyl-3,6-dimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one (PubChem CID 20782550) has the molecular formula C25H28ClNO2 and a molecular weight of 409.96 g/mol. Its IUPAC name is 4-[(E)-2-[5-(2-chlorophenyl)-2-pyridinyl]ethenyl]-5-ethyl-3,6-dimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one.
| Compound Name | 4-[(E)-2-[5-(2-chlorophenyl)-2-pyridinyl]ethenyl]-5-ethyl-3,6-dimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 20782550 |
| Molecular Formula | C25H28ClNO2 |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 4-[(E)-2-[5-(2-chlorophenyl)-2-pyridinyl]ethenyl]-5-ethyl-3,6-dimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
| SMILES | CCC1C(C)CC2C(=O)OC(C)C2C1/C=C/c1ccc(-c2ccccc2Cl)cn1 |
| InChI | InChI=1S/C25H28ClNO2/c1-4-19-15(2)13-22-24(16(3)29-25(22)28)21(19)12-11-18-10-9-17(14-27-18)20-7-5-6-8-23(20)26/h5-12,14-16,19,21-22,24H,4,13H2,1-3H3/b12-11+ |
| InChIKey | RMCFJOVRINBNGZ-VAWYXSNFSA-N |
| XLogP | 6.28 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |