C17H28 — CID 20782773
1,2,3,4,4,5,5,6,6-nonamethyl-1H-pentalene (PubChem CID 20782773) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is 1,2,3,4,4,5,5,6,6-nonamethyl-1H-pentalene.
| Compound Name | 1,2,3,4,4,5,5,6,6-nonamethyl-1H-pentalene |
|---|---|
| PubChem CID | 20782773 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 1,2,3,4,4,5,5,6,6-nonamethyl-1H-pentalene |
| SMILES | CC1=C(C)C(C)C2=C1C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C17H28/c1-10-11(2)13-14(12(10)3)16(6,7)17(8,9)15(13,4)5/h11H,1-9H3 |
| InChIKey | MONHRIMKGVADDA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |