About (4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methyl 2-bromo-2-methylpropanoate
(4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methyl 2-bromo-2-methylpropanoate (PubChem CID 20782780) has the molecular formula C10H14BrNO4
and a molecular weight of 292.13 g/mol. Its IUPAC name is (4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methyl 2-bromo-2-methylpropanoate.
Molecular Properties
| Compound Name | (4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methyl 2-bromo-2-methylpropanoate |
| PubChem CID | 20782780 |
| Molecular Formula | C10H14BrNO4 |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | (4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methyl 2-bromo-2-methylpropanoate |
| SMILES | CC(C)(Br)C(=O)OCC1=NC(C)(C)C(=O)O1 |
| InChI | InChI=1S/C10H14BrNO4/c1-9(2,11)7(13)15-5-6-12-10(3,4)8(14)16-6/h5H2,1-4H3 |
| InChIKey | QQQJNYNZQSSHOP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methyl 2-bromo-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methyl 2-bromo-2-methylpropanoate?
The IUPAC name of (4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methyl 2-bromo-2-methylpropanoate (CID 20782780) is (4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methyl 2-bromo-2-methylpropanoate.
What is the SMILES notation for (4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methyl 2-bromo-2-methylpropanoate?
The canonical SMILES for (4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methyl 2-bromo-2-methylpropanoate is CC(C)(Br)C(=O)OCC1=NC(C)(C)C(=O)O1.
What is the InChIKey of (4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methyl 2-bromo-2-methylpropanoate?
The InChIKey is QQQJNYNZQSSHOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrNO4/c1-9(2,11)7(13)15-5-6-12-10(3,4)8(14)16-6/h5H2,1-4H3.
What are the key properties of (4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methyl 2-bromo-2-methylpropanoate?
(4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methyl 2-bromo-2-methylpropanoate has a molecular weight of 292.13 g/mol, XLogP of 1.44, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methyl 2-bromo-2-methylpropanoate is sourced from PubChem (CID 20782780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).