C22H32N2O4 — CID 20782867
2-[2-[(1-carboxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanylidene)amino]ethylimino]-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid (PubChem CID 20782867) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-[2-[(1-carboxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanylidene)amino]ethylimino]-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid.
| Compound Name | 2-[2-[(1-carboxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanylidene)amino]ethylimino]-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid |
|---|---|
| PubChem CID | 20782867 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 2-[2-[(1-carboxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanylidene)amino]ethylimino]-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid |
| SMILES | CC1(C)C2CCC1(C(=O)O)/C(=N/CC/N=C1\CC3CCC1(C(=O)O)C3(C)C)C2 |
| InChI | InChI=1S/C22H32N2O4/c1-19(2)13-5-7-21(19,17(25)26)15(11-13)23-9-10-24-16-12-14-6-8-22(16,18(27)28)20(14,3)4/h13-14H,5-12H2,1-4H3,(H,25,26)(H,27,28)/b23-15+,24-16+ |
| InChIKey | ZCIZSLZLOVLZFJ-DFEHQXHXSA-N |
| XLogP | 3.69 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|