C25H21ClN2O7S3 — CID 20783261
[2-[2-[[5-chloro-3-(sulfomethyl)-1,3-benzothiazol-3-ium-2-yl]methyl]but-1-enylidene]benzo[e][1,3]benzoxazol-1-yl]methanesulfonate (PubChem CID 20783261) has the molecular formula C25H21ClN2O7S3 and a molecular weight of 593.10 g/mol. Its IUPAC name is [2-[2-[[5-chloro-3-(sulfomethyl)-1,3-benzothiazol-3-ium-2-yl]methyl]but-1-enylidene]benzo[e][1,3]benzoxazol-1-yl]methanesulfonate.
| Compound Name | [2-[2-[[5-chloro-3-(sulfomethyl)-1,3-benzothiazol-3-ium-2-yl]methyl]but-1-enylidene]benzo[e][1,3]benzoxazol-1-yl]methanesulfonate |
|---|---|
| PubChem CID | 20783261 |
| Molecular Formula | C25H21ClN2O7S3 |
| Molecular Weight | 593.10 g/mol |
| Exact Mass | 592.02 |
| IUPAC Name | [2-[2-[[5-chloro-3-(sulfomethyl)-1,3-benzothiazol-3-ium-2-yl]methyl]but-1-enylidene]benzo[e][1,3]benzoxazol-1-yl]methanesulfonate |
| SMILES | CCC(=C=C1Oc2ccc3ccccc3c2N1CS(=O)(=O)[O-])Cc1sc2ccc(Cl)cc2[n+]1CS(=O)(=O)O |
| InChI | InChI=1S/C25H21ClN2O7S3/c1-2-16(12-24-27(14-37(29,30)31)20-13-18(26)8-10-22(20)36-24)11-23-28(15-38(32,33)34)25-19-6-4-3-5-17(19)7-9-21(25)35-23/h3-10,13H,2,12,14-15H2,1H3,(H-,29,30,31,32,33,34) |
| InChIKey | XGMCXKDBYLDKPB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.10 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|