About 3-(2,3-difluorophenyl)-8-methyl-1,3-benzoxazin-3-ium-2-one
3-(2,3-difluorophenyl)-8-methyl-1,3-benzoxazin-3-ium-2-one (PubChem CID 20783336) has the molecular formula C15H10F2NO2+
and a molecular weight of 274.25 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-8-methyl-1,3-benzoxazin-3-ium-2-one.
Molecular Properties
| Compound Name | 3-(2,3-difluorophenyl)-8-methyl-1,3-benzoxazin-3-ium-2-one |
| PubChem CID | 20783336 |
| Molecular Formula | C15H10F2NO2+ |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 3-(2,3-difluorophenyl)-8-methyl-1,3-benzoxazin-3-ium-2-one |
| SMILES | Cc1cccc2c[n+](-c3cccc(F)c3F)c(=O)oc12 |
| InChI | InChI=1S/C15H10F2NO2/c1-9-4-2-5-10-8-18(15(19)20-14(9)10)12-7-3-6-11(16)13(12)17/h2-8H,1H3/q+1 |
| InChIKey | QSAKPLIXPVOPPD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 34.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3-difluorophenyl)-8-methyl-1,3-benzoxazin-3-ium-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-difluorophenyl)-8-methyl-1,3-benzoxazin-3-ium-2-one?
The IUPAC name of 3-(2,3-difluorophenyl)-8-methyl-1,3-benzoxazin-3-ium-2-one (CID 20783336) is 3-(2,3-difluorophenyl)-8-methyl-1,3-benzoxazin-3-ium-2-one.
What is the SMILES notation for 3-(2,3-difluorophenyl)-8-methyl-1,3-benzoxazin-3-ium-2-one?
The canonical SMILES for 3-(2,3-difluorophenyl)-8-methyl-1,3-benzoxazin-3-ium-2-one is Cc1cccc2c[n+](-c3cccc(F)c3F)c(=O)oc12.
What is the InChIKey of 3-(2,3-difluorophenyl)-8-methyl-1,3-benzoxazin-3-ium-2-one?
The InChIKey is QSAKPLIXPVOPPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F2NO2/c1-9-4-2-5-10-8-18(15(19)20-14(9)10)12-7-3-6-11(16)13(12)17/h2-8H,1H3/q+1.
What are the key properties of 3-(2,3-difluorophenyl)-8-methyl-1,3-benzoxazin-3-ium-2-one?
3-(2,3-difluorophenyl)-8-methyl-1,3-benzoxazin-3-ium-2-one has a molecular weight of 274.25 g/mol, XLogP of 2.66, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-difluorophenyl)-8-methyl-1,3-benzoxazin-3-ium-2-one is sourced from PubChem (CID 20783336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).