About 3-(2,6-difluorophenyl)-8-methyl-2H-1,3-benzoxazin-3-ium
3-(2,6-difluorophenyl)-8-methyl-2H-1,3-benzoxazin-3-ium (PubChem CID 20783355) has the molecular formula C15H12F2NO+
and a molecular weight of 260.26 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-8-methyl-2H-1,3-benzoxazin-3-ium.
Molecular Properties
| Compound Name | 3-(2,6-difluorophenyl)-8-methyl-2H-1,3-benzoxazin-3-ium |
| PubChem CID | 20783355 |
| Molecular Formula | C15H12F2NO+ |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 3-(2,6-difluorophenyl)-8-methyl-2H-1,3-benzoxazin-3-ium |
| SMILES | Cc1cccc2c1OC[N+](c1c(F)cccc1F)=C2 |
| InChI | InChI=1S/C15H12F2NO/c1-10-4-2-5-11-8-18(9-19-15(10)11)14-12(16)6-3-7-13(14)17/h2-8H,9H2,1H3/q+1 |
| InChIKey | YBPVXUXLAVCRGF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,6-difluorophenyl)-8-methyl-2H-1,3-benzoxazin-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-difluorophenyl)-8-methyl-2H-1,3-benzoxazin-3-ium?
The IUPAC name of 3-(2,6-difluorophenyl)-8-methyl-2H-1,3-benzoxazin-3-ium (CID 20783355) is 3-(2,6-difluorophenyl)-8-methyl-2H-1,3-benzoxazin-3-ium.
What is the SMILES notation for 3-(2,6-difluorophenyl)-8-methyl-2H-1,3-benzoxazin-3-ium?
The canonical SMILES for 3-(2,6-difluorophenyl)-8-methyl-2H-1,3-benzoxazin-3-ium is Cc1cccc2c1OC[N+](c1c(F)cccc1F)=C2.
What is the InChIKey of 3-(2,6-difluorophenyl)-8-methyl-2H-1,3-benzoxazin-3-ium?
The InChIKey is YBPVXUXLAVCRGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F2NO/c1-10-4-2-5-11-8-18(9-19-15(10)11)14-12(16)6-3-7-13(14)17/h2-8H,9H2,1H3/q+1.
What are the key properties of 3-(2,6-difluorophenyl)-8-methyl-2H-1,3-benzoxazin-3-ium?
3-(2,6-difluorophenyl)-8-methyl-2H-1,3-benzoxazin-3-ium has a molecular weight of 260.26 g/mol, XLogP of 3.39, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-difluorophenyl)-8-methyl-2H-1,3-benzoxazin-3-ium is sourced from PubChem (CID 20783355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).