About CID 20783420
CID 20783420 (PubChem CID 20783420) has the molecular formula C5H8BN2+
and a molecular weight of 106.94 g/mol.
Molecular Properties
| Compound Name | CID 20783420 |
| PubChem CID | 20783420 |
| Molecular Formula | C5H8BN2+ |
| Molecular Weight | 106.94 g/mol |
| Exact Mass | 107.08 |
| IUPAC Name | — |
| SMILES | [B][N+]1=NC(C)=CC1C |
| InChI | InChI=1S/C5H8BN2/c1-4-3-5(2)8(6)7-4/h3,5H,1-2H3/q+1 |
| InChIKey | HLJNHZRNTYKEKV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.94 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 20783420 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20783420?
The IUPAC name of CID 20783420 (CID 20783420) is not available.
What is the SMILES notation for CID 20783420?
The canonical SMILES for CID 20783420 is [B][N+]1=NC(C)=CC1C.
What is the InChIKey of CID 20783420?
The InChIKey is HLJNHZRNTYKEKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8BN2/c1-4-3-5(2)8(6)7-4/h3,5H,1-2H3/q+1.
What are the key properties of CID 20783420?
CID 20783420 has a molecular weight of 106.94 g/mol, XLogP of 0.84, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20783420 is sourced from PubChem (CID 20783420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).