About 3-(cyclohexylmethyl)-6-methoxy-8-(2-phenylpropan-2-yl)-2H-1,3-benzoxazin-3-ium
3-(cyclohexylmethyl)-6-methoxy-8-(2-phenylpropan-2-yl)-2H-1,3-benzoxazin-3-ium (PubChem CID 20783484) has the molecular formula C25H32NO2+
and a molecular weight of 378.54 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-6-methoxy-8-(2-phenylpropan-2-yl)-2H-1,3-benzoxazin-3-ium.
Molecular Properties
| Compound Name | 3-(cyclohexylmethyl)-6-methoxy-8-(2-phenylpropan-2-yl)-2H-1,3-benzoxazin-3-ium |
| PubChem CID | 20783484 |
| Molecular Formula | C25H32NO2+ |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 3-(cyclohexylmethyl)-6-methoxy-8-(2-phenylpropan-2-yl)-2H-1,3-benzoxazin-3-ium |
| SMILES | COc1cc2c(c(C(C)(C)c3ccccc3)c1)OC[N+](CC1CCCCC1)=C2 |
| InChI | InChI=1S/C25H32NO2/c1-25(2,21-12-8-5-9-13-21)23-15-22(27-3)14-20-17-26(18-28-24(20)23)16-19-10-6-4-7-11-19/h5,8-9,12-15,17,19H,4,6-7,10-11,16,18H2,1-3H3/q+1 |
| InChIKey | NFODALXPKDOBAI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(cyclohexylmethyl)-6-methoxy-8-(2-phenylpropan-2-yl)-2H-1,3-benzoxazin-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclohexylmethyl)-6-methoxy-8-(2-phenylpropan-2-yl)-2H-1,3-benzoxazin-3-ium?
The IUPAC name of 3-(cyclohexylmethyl)-6-methoxy-8-(2-phenylpropan-2-yl)-2H-1,3-benzoxazin-3-ium (CID 20783484) is 3-(cyclohexylmethyl)-6-methoxy-8-(2-phenylpropan-2-yl)-2H-1,3-benzoxazin-3-ium.
What is the SMILES notation for 3-(cyclohexylmethyl)-6-methoxy-8-(2-phenylpropan-2-yl)-2H-1,3-benzoxazin-3-ium?
The canonical SMILES for 3-(cyclohexylmethyl)-6-methoxy-8-(2-phenylpropan-2-yl)-2H-1,3-benzoxazin-3-ium is COc1cc2c(c(C(C)(C)c3ccccc3)c1)OC[N+](CC1CCCCC1)=C2.
What is the InChIKey of 3-(cyclohexylmethyl)-6-methoxy-8-(2-phenylpropan-2-yl)-2H-1,3-benzoxazin-3-ium?
The InChIKey is NFODALXPKDOBAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32NO2/c1-25(2,21-12-8-5-9-13-21)23-15-22(27-3)14-20-17-26(18-28-24(20)23)16-19-10-6-4-7-11-19/h5,8-9,12-15,17,19H,4,6-7,10-11,16,18H2,1-3H3/q+1.
What are the key properties of 3-(cyclohexylmethyl)-6-methoxy-8-(2-phenylpropan-2-yl)-2H-1,3-benzoxazin-3-ium?
3-(cyclohexylmethyl)-6-methoxy-8-(2-phenylpropan-2-yl)-2H-1,3-benzoxazin-3-ium has a molecular weight of 378.54 g/mol, XLogP of 5.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclohexylmethyl)-6-methoxy-8-(2-phenylpropan-2-yl)-2H-1,3-benzoxazin-3-ium is sourced from PubChem (CID 20783484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).