C18H21N2O+ — CID 20783578
4-(6,8-dimethyl-2H-1,3-benzoxazin-3-ium-3-yl)-N,N-dimethylaniline (PubChem CID 20783578) has the molecular formula C18H21N2O+ and a molecular weight of 281.38 g/mol. Its IUPAC name is 4-(6,8-dimethyl-2H-1,3-benzoxazin-3-ium-3-yl)-N,N-dimethylaniline.
| Compound Name | 4-(6,8-dimethyl-2H-1,3-benzoxazin-3-ium-3-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 20783578 |
| Molecular Formula | C18H21N2O+ |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 4-(6,8-dimethyl-2H-1,3-benzoxazin-3-ium-3-yl)-N,N-dimethylaniline |
| SMILES | Cc1cc(C)c2c(c1)C=[N+](c1ccc(N(C)C)cc1)CO2 |
| InChI | InChI=1S/C18H21N2O/c1-13-9-14(2)18-15(10-13)11-20(12-21-18)17-7-5-16(6-8-17)19(3)4/h5-11H,12H2,1-4H3/q+1 |
| InChIKey | QPQNFSVDXCUYCR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|