About 3-cyclohexyl-1,3-benzothiazin-3-ium-2-one
3-cyclohexyl-1,3-benzothiazin-3-ium-2-one (PubChem CID 20783596) has the molecular formula C14H16NOS+
and a molecular weight of 246.35 g/mol. Its IUPAC name is 3-cyclohexyl-1,3-benzothiazin-3-ium-2-one.
Molecular Properties
| Compound Name | 3-cyclohexyl-1,3-benzothiazin-3-ium-2-one |
| PubChem CID | 20783596 |
| Molecular Formula | C14H16NOS+ |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 3-cyclohexyl-1,3-benzothiazin-3-ium-2-one |
| SMILES | O=c1sc2ccccc2c[n+]1C1CCCCC1 |
| InChI | InChI=1S/C14H16NOS/c16-14-15(12-7-2-1-3-8-12)10-11-6-4-5-9-13(11)17-14/h4-6,9-10,12H,1-3,7-8H2/q+1 |
| InChIKey | ZJXHUMBCMQFMSM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexyl-1,3-benzothiazin-3-ium-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-1,3-benzothiazin-3-ium-2-one?
The IUPAC name of 3-cyclohexyl-1,3-benzothiazin-3-ium-2-one (CID 20783596) is 3-cyclohexyl-1,3-benzothiazin-3-ium-2-one.
What is the SMILES notation for 3-cyclohexyl-1,3-benzothiazin-3-ium-2-one?
The canonical SMILES for 3-cyclohexyl-1,3-benzothiazin-3-ium-2-one is O=c1sc2ccccc2c[n+]1C1CCCCC1.
What is the InChIKey of 3-cyclohexyl-1,3-benzothiazin-3-ium-2-one?
The InChIKey is ZJXHUMBCMQFMSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16NOS/c16-14-15(12-7-2-1-3-8-12)10-11-6-4-5-9-13(11)17-14/h4-6,9-10,12H,1-3,7-8H2/q+1.
What are the key properties of 3-cyclohexyl-1,3-benzothiazin-3-ium-2-one?
3-cyclohexyl-1,3-benzothiazin-3-ium-2-one has a molecular weight of 246.35 g/mol, XLogP of 3.05, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-1,3-benzothiazin-3-ium-2-one is sourced from PubChem (CID 20783596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).