C22H18N4+2 — CID 20783920
1,3-diaza-12,16-diazoniaheptacyclo[16.6.1.13,6.02,12.02,16.022,25.010,26]hexacosa-4,6(26),7,9,11,16,18,20,22(25),23-decaene (PubChem CID 20783920) has the molecular formula C22H18N4+2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1,3-diaza-12,16-diazoniaheptacyclo[16.6.1.13,6.02,12.02,16.022,25.010,26]hexacosa-4,6(26),7,9,11,16,18,20,22(25),23-decaene.
| Compound Name | 1,3-diaza-12,16-diazoniaheptacyclo[16.6.1.13,6.02,12.02,16.022,25.010,26]hexacosa-4,6(26),7,9,11,16,18,20,22(25),23-decaene |
|---|---|
| PubChem CID | 20783920 |
| Molecular Formula | C22H18N4+2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1,3-diaza-12,16-diazoniaheptacyclo[16.6.1.13,6.02,12.02,16.022,25.010,26]hexacosa-4,6(26),7,9,11,16,18,20,22(25),23-decaene |
| SMILES | C1=[N+]2CCC[N+]3=Cc4cccc5ccn(c45)C23n2ccc3cccc1c32 |
| InChI | InChI=1S/C22H18N4/c1-4-16-8-12-25-20(16)18(6-1)14-23-10-3-11-24-15-19-7-2-5-17-9-13-26(21(17)19)22(23,24)25/h1-2,4-9,12-15H,3,10-11H2/q+2 |
| InChIKey | WDRMBAGZMFAWFV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 15.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|