C18H9F6N2O+ — CID 20783984
10-[2,6-bis(trifluoromethyl)phenyl]-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one (PubChem CID 20783984) has the molecular formula C18H9F6N2O+ and a molecular weight of 383.27 g/mol. Its IUPAC name is 10-[2,6-bis(trifluoromethyl)phenyl]-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one.
| Compound Name | 10-[2,6-bis(trifluoromethyl)phenyl]-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one |
|---|---|
| PubChem CID | 20783984 |
| Molecular Formula | C18H9F6N2O+ |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 10-[2,6-bis(trifluoromethyl)phenyl]-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one |
| SMILES | O=c1n2ccc3cccc(c[n+]1-c1c(C(F)(F)F)cccc1C(F)(F)F)c32 |
| InChI | InChI=1S/C18H9F6N2O/c19-17(20,21)12-5-2-6-13(18(22,23)24)15(12)26-9-11-4-1-3-10-7-8-25(14(10)11)16(26)27/h1-9H/q+1 |
| InChIKey | HETGBJBRWALJRO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|